C9H18N2O2 — CID 141497199
tert-butyl 1,3-diaminocyclobutane-1-carboxylate (PubChem CID 141497199) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is tert-butyl 1,3-diaminocyclobutane-1-carboxylate.
| Compound Name | tert-butyl 1,3-diaminocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 141497199 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | tert-butyl 1,3-diaminocyclobutane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(N)CC(N)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-8(2,3)13-7(12)9(11)4-6(10)5-9/h6H,4-5,10-11H2,1-3H3 |
| InChIKey | QHFHVAFTZAZYJG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |