About trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate
trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate (PubChem CID 68828762) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate.
Analyze trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate?
The IUPAC name of trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate (CID 68828762) is trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate.
What is the SMILES notation for trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate?
The canonical SMILES for trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate is CC(C)(C)OC(=O)[C@]1(N)CCC[C@H]1N.
What is the InChIKey of trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate?
The InChIKey is QRFQNBLCNCMMRS-XCBNKYQSSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-9(2,3)14-8(13)10(12)6-4-5-7(10)11/h7H,4-6,11-12H2,1-3H3/t7-,10+/m1/s1.
What are the key properties of trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate?
trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate has a molecular weight of 200.28 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-tert-butyl (1S,2R)-1,2-diaminocyclopentane-1-carboxylate is sourced from PubChem (CID 68828762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).