C15H29NO2 — CID 125425759
tert-butyl 1-amino-4-tert-butylcyclohexane-1-carboxylate (PubChem CID 125425759) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is tert-butyl 1-amino-4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | tert-butyl 1-amino-4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 125425759 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | tert-butyl 1-amino-4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(N)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-13(2,3)11-7-9-15(16,10-8-11)12(17)18-14(4,5)6/h11H,7-10,16H2,1-6H3 |
| InChIKey | MSMPBLWYABILBQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |