C11H19NO3 — CID 97115095
cis-tert-butyl (1R,2R)-2-amino-2-formylcyclopentane-1-carboxylate (PubChem CID 97115095) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is cis-tert-butyl (1R,2R)-2-amino-2-formylcyclopentane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,2R)-2-amino-2-formylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 97115095 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | cis-tert-butyl (1R,2R)-2-amino-2-formylcyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC[C@]1(N)C=O |
| InChI | InChI=1S/C11H19NO3/c1-10(2,3)15-9(14)8-5-4-6-11(8,12)7-13/h7-8H,4-6,12H2,1-3H3/t8-,11-/m0/s1 |
| InChIKey | HXISAKDBCXECSZ-KWQFWETISA-N |
| XLogP | 1.02 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|