C13H21ClO4 — CID 23158970
ditert-butyl 1-chlorocyclopropane-1,2-dicarboxylate (PubChem CID 23158970) has the molecular formula C13H21ClO4 and a molecular weight of 276.76 g/mol. Its IUPAC name is ditert-butyl 1-chlorocyclopropane-1,2-dicarboxylate.
| Compound Name | ditert-butyl 1-chlorocyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23158970 |
| Molecular Formula | C13H21ClO4 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | ditert-butyl 1-chlorocyclopropane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC1(Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21ClO4/c1-11(2,3)17-9(15)8-7-13(8,14)10(16)18-12(4,5)6/h8H,7H2,1-6H3 |
| InChIKey | NBCBQQZMBMXIDG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|