C10H16Cl2O2 — CID 2780298
tert-butyl 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate (PubChem CID 2780298) has the molecular formula C10H16Cl2O2 and a molecular weight of 239.14 g/mol. Its IUPAC name is tert-butyl 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2780298 |
| Molecular Formula | C10H16Cl2O2 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | tert-butyl 2,2-dichloro-3,3-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C(C)(C)C1(Cl)Cl |
| InChI | InChI=1S/C10H16Cl2O2/c1-8(2,3)14-7(13)6-9(4,5)10(6,11)12/h6H,1-5H3 |
| InChIKey | LNEFGAYKTMMXDW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|