C12H20Cl2O2 — CID 21417878
tert-butyl 2,2-dichloro-3,3-diethylcyclopropane-1-carboxylate (PubChem CID 21417878) has the molecular formula C12H20Cl2O2 and a molecular weight of 267.20 g/mol. Its IUPAC name is tert-butyl 2,2-dichloro-3,3-diethylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl 2,2-dichloro-3,3-diethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 21417878 |
| Molecular Formula | C12H20Cl2O2 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | tert-butyl 2,2-dichloro-3,3-diethylcyclopropane-1-carboxylate |
| SMILES | CCC1(CC)C(C(=O)OC(C)(C)C)C1(Cl)Cl |
| InChI | InChI=1S/C12H20Cl2O2/c1-6-11(7-2)8(12(11,13)14)9(15)16-10(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | YGXMKQWNCHFRMH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|