C9H14Cl2O2 — CID 102246878
cis-tert-butyl (1S,3R)-2,2-dichloro-3-methylcyclopropane-1-carboxylate (PubChem CID 102246878) has the molecular formula C9H14Cl2O2 and a molecular weight of 225.11 g/mol. Its IUPAC name is cis-tert-butyl (1S,3R)-2,2-dichloro-3-methylcyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1S,3R)-2,2-dichloro-3-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102246878 |
| Molecular Formula | C9H14Cl2O2 |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | cis-tert-butyl (1S,3R)-2,2-dichloro-3-methylcyclopropane-1-carboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)OC(C)(C)C)C1(Cl)Cl |
| InChI | InChI=1S/C9H14Cl2O2/c1-5-6(9(5,10)11)7(12)13-8(2,3)4/h5-6H,1-4H3/t5-,6+/m1/s1 |
| InChIKey | BJHJGWJVMMWZGY-RITPCOANSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|