C8H12Cl2O2 — CID 7003899
tert-butyl (1R)-2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 7003899) has the molecular formula C8H12Cl2O2 and a molecular weight of 211.09 g/mol. Its IUPAC name is tert-butyl (1R)-2,2-dichlorocyclopropane-1-carboxylate.
| Compound Name | tert-butyl (1R)-2,2-dichlorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7003899 |
| Molecular Formula | C8H12Cl2O2 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | tert-butyl (1R)-2,2-dichlorocyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C8H12Cl2O2/c1-7(2,3)12-6(11)5-4-8(5,9)10/h5H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | LJLQISYXQQRLDM-RXMQYKEDSA-N |
| XLogP | 2.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|