C10H16Cl2O2S — CID 117063224
cis-tert-butyl (1S,3S)-2,2-dichloro-3-methyl-1-methylsulfanylcyclopropane-1-carboxylate (PubChem CID 117063224) has the molecular formula C10H16Cl2O2S and a molecular weight of 271.21 g/mol. Its IUPAC name is cis-tert-butyl (1S,3S)-2,2-dichloro-3-methyl-1-methylsulfanylcyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1S,3S)-2,2-dichloro-3-methyl-1-methylsulfanylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 117063224 |
| Molecular Formula | C10H16Cl2O2S |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | cis-tert-butyl (1S,3S)-2,2-dichloro-3-methyl-1-methylsulfanylcyclopropane-1-carboxylate |
| SMILES | CS[C@]1(C(=O)OC(C)(C)C)[C@H](C)C1(Cl)Cl |
| InChI | InChI=1S/C10H16Cl2O2S/c1-6-9(15-5,10(6,11)12)7(13)14-8(2,3)4/h6H,1-5H3/t6-,9-/m0/s1 |
| InChIKey | PWUIWMOUASVEJR-RCOVLWMOSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|