C10H17NO2 — CID 174102774
tert-butyl (4R)-1,4-dimethyl-2-azabicyclo[1.1.0]butane-2-carboxylate (PubChem CID 174102774) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is tert-butyl (4R)-1,4-dimethyl-2-azabicyclo[1.1.0]butane-2-carboxylate.
| Compound Name | tert-butyl (4R)-1,4-dimethyl-2-azabicyclo[1.1.0]butane-2-carboxylate |
|---|---|
| PubChem CID | 174102774 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | tert-butyl (4R)-1,4-dimethyl-2-azabicyclo[1.1.0]butane-2-carboxylate |
| SMILES | C[C@@H]1C2N(C(=O)OC(C)(C)C)C21C |
| InChI | InChI=1S/C10H17NO2/c1-6-7-10(6,5)11(7)8(12)13-9(2,3)4/h6-7H,1-5H3/t6-,7?,10?,11?/m1/s1 |
| InChIKey | HCRRUHDQZQKEAS-JRVZNZQRSA-N |
| XLogP | 2.01 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|