About tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate
tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate (PubChem CID 162451549) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate.
Analyze tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate (CID 162451549) is tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate is CC1CN(C(=O)OC(C)(C)C)CC(C)C1(C)O.
What is the InChIKey of tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate?
The InChIKey is ISGCWHRGTGOEJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-9-7-14(8-10(2)13(9,6)16)11(15)17-12(3,4)5/h9-10,16H,7-8H2,1-6H3.
What are the key properties of tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate?
tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate has a molecular weight of 243.35 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-hydroxy-3,4,5-trimethylpiperidine-1-carboxylate is sourced from PubChem (CID 162451549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).