C15H27NO3 — CID 162493695
tert-butyl 8-hydroxy-8-propan-2-yl-3-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 162493695) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is tert-butyl 8-hydroxy-8-propan-2-yl-3-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | tert-butyl 8-hydroxy-8-propan-2-yl-3-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 162493695 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | tert-butyl 8-hydroxy-8-propan-2-yl-3-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)C1(O)C2CCC1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C15H27NO3/c1-10(2)15(18)11-6-7-12(15)9-16(8-11)13(17)19-14(3,4)5/h10-12,18H,6-9H2,1-5H3 |
| InChIKey | XEEQVFJQNWENNQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |