C12H19F2NO2 — CID 90224767
tert-butyl 5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 90224767) has the molecular formula C12H19F2NO2 and a molecular weight of 247.28 g/mol. Its IUPAC name is tert-butyl 5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 90224767 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl 5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(F)(F)CC2C1 |
| InChI | InChI=1S/C12H19F2NO2/c1-11(2,3)17-10(16)15-6-8-4-12(13,14)5-9(8)7-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | OFBZVNZTLZMPMB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |