C13H19F3N2O3 — CID 167383689
tert-butyl (3aS,6aR)-2-(2,2,2-trifluoroacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 167383689) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-2-(2,2,2-trifluoroacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-2-(2,2,2-trifluoroacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 167383689 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | tert-butyl (3aS,6aR)-2-(2,2,2-trifluoroacetyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CN(C(=O)C(F)(F)F)C[C@@H]2C1 |
| InChI | InChI=1S/C13H19F3N2O3/c1-12(2,3)21-11(20)18-6-8-4-17(5-9(8)7-18)10(19)13(14,15)16/h8-9H,4-7H2,1-3H3/t8-,9+ |
| InChIKey | FIOMDULZLUSRBH-DTORHVGOSA-N |
| XLogP | 1.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |