C14H24FNO3 — CID 115050803
tert-butyl 7-fluoro-9-hydroxy-7-methyl-3-azabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 115050803) has the molecular formula C14H24FNO3 and a molecular weight of 273.35 g/mol. Its IUPAC name is tert-butyl 7-fluoro-9-hydroxy-7-methyl-3-azabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | tert-butyl 7-fluoro-9-hydroxy-7-methyl-3-azabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 115050803 |
| Molecular Formula | C14H24FNO3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | tert-butyl 7-fluoro-9-hydroxy-7-methyl-3-azabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | CC1(F)CC2CN(C(=O)OC(C)(C)C)CC(C1)C2O |
| InChI | InChI=1S/C14H24FNO3/c1-13(2,3)19-12(18)16-7-9-5-14(4,15)6-10(8-16)11(9)17/h9-11,17H,5-8H2,1-4H3 |
| InChIKey | IIXVZKKIKITKHH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |