C12H19BrFNO2 — CID 171713534
tert-butyl 6-(bromomethyl)-6-fluoro-3-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 171713534) has the molecular formula C12H19BrFNO2 and a molecular weight of 308.19 g/mol. Its IUPAC name is tert-butyl 6-(bromomethyl)-6-fluoro-3-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | tert-butyl 6-(bromomethyl)-6-fluoro-3-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 171713534 |
| Molecular Formula | C12H19BrFNO2 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | tert-butyl 6-(bromomethyl)-6-fluoro-3-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(F)(CBr)C2C1 |
| InChI | InChI=1S/C12H19BrFNO2/c1-11(2,3)17-10(16)15-5-8-4-12(14,7-13)9(8)6-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | DNZNECAUOWSAEZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|