C11H18FNO3 — CID 146464347
tert-butyl 6-fluoro-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 146464347) has the molecular formula C11H18FNO3 and a molecular weight of 231.27 g/mol. Its IUPAC name is tert-butyl 6-fluoro-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl 6-fluoro-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 146464347 |
| Molecular Formula | C11H18FNO3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl 6-fluoro-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C(C1)C2(F)CO |
| InChI | InChI=1S/C11H18FNO3/c1-10(2,3)16-9(15)13-4-7-8(5-13)11(7,12)6-14/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | HGXXSWHTGCFYHH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |