C12H22N2O3 — CID 66630657
tert-butyl 5-carbamoyl-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 66630657) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl 5-carbamoyl-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-carbamoyl-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66630657 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl 5-carbamoyl-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C(N)=O)CCC1(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-11(2,3)17-10(16)14-8(9(13)15)6-7-12(14,4)5/h8H,6-7H2,1-5H3,(H2,13,15) |
| InChIKey | MRABVSAILJWLEI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |