C12H22N2O3S — CID 155245632
tert-butyl (2R)-2-carbamoyl-5-methylsulfanylpiperidine-1-carboxylate (PubChem CID 155245632) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-carbamoyl-5-methylsulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-carbamoyl-5-methylsulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155245632 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | tert-butyl (2R)-2-carbamoyl-5-methylsulfanylpiperidine-1-carboxylate |
| SMILES | CSC1CC[C@H](C(N)=O)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H22N2O3S/c1-12(2,3)17-11(16)14-7-8(18-4)5-6-9(14)10(13)15/h8-9H,5-7H2,1-4H3,(H2,13,15)/t8?,9-/m1/s1 |
| InChIKey | AVBADDRXYKYHMC-YGPZHTELSA-N |
| XLogP | 1.60 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |