C20H37NO3 — CID 176970704
tert-butyl 2,2-dimethyl-5-(2-methyl-8-oxooctan-4-yl)pyrrolidine-1-carboxylate (PubChem CID 176970704) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-5-(2-methyl-8-oxooctan-4-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-5-(2-methyl-8-oxooctan-4-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176970704 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | tert-butyl 2,2-dimethyl-5-(2-methyl-8-oxooctan-4-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)CC(CCCC=O)C1CCC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO3/c1-15(2)14-16(10-8-9-13-22)17-11-12-20(6,7)21(17)18(23)24-19(3,4)5/h13,15-17H,8-12,14H2,1-7H3 |
| InChIKey | JJCLGMYIETXCAA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|