C11H20N2O3 — CID 20626547
tert-butyl 5-formyl-2,2-dimethylimidazolidine-1-carboxylate (PubChem CID 20626547) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is tert-butyl 5-formyl-2,2-dimethylimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 5-formyl-2,2-dimethylimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 20626547 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl 5-formyl-2,2-dimethylimidazolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C=O)CNC1(C)C |
| InChI | InChI=1S/C11H20N2O3/c1-10(2,3)16-9(15)13-8(7-14)6-12-11(13,4)5/h7-8,12H,6H2,1-5H3 |
| InChIKey | GTPDCKSRTDJNNQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|