C10H17NO5S — CID 84807201
tert-butyl 3-formyl-1,1-dioxo-1,4-thiazinane-4-carboxylate (PubChem CID 84807201) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is tert-butyl 3-formyl-1,1-dioxo-1,4-thiazinane-4-carboxylate.
| Compound Name | tert-butyl 3-formyl-1,1-dioxo-1,4-thiazinane-4-carboxylate |
|---|---|
| PubChem CID | 84807201 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | tert-butyl 3-formyl-1,1-dioxo-1,4-thiazinane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)CC1C=O |
| InChI | InChI=1S/C10H17NO5S/c1-10(2,3)16-9(13)11-4-5-17(14,15)7-8(11)6-12/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | HJKVKGMGKOAHNL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|