C11H21NO5 — CID 143021832
tert-butyl 2-formyl-4-hydroxypyrrolidine-1-carboxylate;methanol (PubChem CID 143021832) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is tert-butyl 2-formyl-4-hydroxypyrrolidine-1-carboxylate;methanol.
| Compound Name | tert-butyl 2-formyl-4-hydroxypyrrolidine-1-carboxylate;methanol |
|---|---|
| PubChem CID | 143021832 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl 2-formyl-4-hydroxypyrrolidine-1-carboxylate;methanol |
| SMILES | CC(C)(C)OC(=O)N1CC(O)CC1C=O.CO |
| InChI | InChI=1S/C10H17NO4.CH4O/c1-10(2,3)15-9(14)11-5-8(13)4-7(11)6-12;1-2/h6-8,13H,4-5H2,1-3H3;2H,1H3 |
| InChIKey | WKCRKFDCECDOCW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|