C12H20N2O4S — CID 59926953
tert-butyl N-[2-[(2S,4S)-2-formyl-4-hydroxypyrrolidin-1-yl]-2-sulfanylideneethyl]carbamate (PubChem CID 59926953) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S,4S)-2-formyl-4-hydroxypyrrolidin-1-yl]-2-sulfanylideneethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S,4S)-2-formyl-4-hydroxypyrrolidin-1-yl]-2-sulfanylideneethyl]carbamate |
|---|---|
| PubChem CID | 59926953 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | tert-butyl N-[2-[(2S,4S)-2-formyl-4-hydroxypyrrolidin-1-yl]-2-sulfanylideneethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=S)N1C[C@@H](O)C[C@H]1C=O |
| InChI | InChI=1S/C12H20N2O4S/c1-12(2,3)18-11(17)13-5-10(19)14-6-9(16)4-8(14)7-15/h7-9,16H,4-6H2,1-3H3,(H,13,17)/t8-,9-/m0/s1 |
| InChIKey | RPSLMEJMADNUAG-IUCAKERBSA-N |
| XLogP | 0.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|