C11H18N2O4S2 — CID 59926974
(2R)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioyl]-1,3-thiazolidine-2-carboxylic acid (PubChem CID 59926974) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2R)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioyl]-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | (2R)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioyl]-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59926974 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2R)-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethanethioyl]-1,3-thiazolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCC(=S)N1CCS[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H18N2O4S2/c1-11(2,3)17-10(16)12-6-7(18)13-4-5-19-8(13)9(14)15/h8H,4-6H2,1-3H3,(H,12,16)(H,14,15)/t8-/m1/s1 |
| InChIKey | DCTMUYFYDQICOK-MRVPVSSYSA-N |
| XLogP | 1.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|