C10H17NO3S — CID 118137125
tert-butyl (2S)-2-acetyl-1,3-thiazolidine-3-carboxylate (PubChem CID 118137125) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is tert-butyl (2S)-2-acetyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (2S)-2-acetyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 118137125 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | tert-butyl (2S)-2-acetyl-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(=O)[C@@H]1SCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO3S/c1-7(12)8-11(5-6-15-8)9(13)14-10(2,3)4/h8H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | JHXOUBMJHIRXNK-QMMMGPOBSA-N |
| XLogP | 1.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |