C9H15NO4S — CID 175387039
tert-butyl 2-formyloxy-1,3-thiazolidine-3-carboxylate (PubChem CID 175387039) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is tert-butyl 2-formyloxy-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl 2-formyloxy-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 175387039 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | tert-butyl 2-formyloxy-1,3-thiazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCSC1OC=O |
| InChI | InChI=1S/C9H15NO4S/c1-9(2,3)14-7(12)10-4-5-15-8(10)13-6-11/h6,8H,4-5H2,1-3H3 |
| InChIKey | BIFSBDCFPRCLEK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|