C10H16FNO4 — CID 121403612
tert-butyl (2R,4S)-4-fluoro-2-formyloxypyrrolidine-1-carboxylate (PubChem CID 121403612) has the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-fluoro-2-formyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-fluoro-2-formyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121403612 |
| Molecular Formula | C10H16FNO4 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | tert-butyl (2R,4S)-4-fluoro-2-formyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1OC=O |
| InChI | InChI=1S/C10H16FNO4/c1-10(2,3)16-9(14)12-5-7(11)4-8(12)15-6-13/h6-8H,4-5H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | NLPZKAIHQLAEDK-JGVFFNPUSA-N |
| XLogP | 1.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|