C10H17FN2O2S — CID 88899008
tert-butyl (2S,4S)-2-carbamothioyl-4-fluoropyrrolidine-1-carboxylate (PubChem CID 88899008) has the molecular formula C10H17FN2O2S and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-carbamothioyl-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-carbamothioyl-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88899008 |
| Molecular Formula | C10H17FN2O2S |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | tert-butyl (2S,4S)-2-carbamothioyl-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1C(N)=S |
| InChI | InChI=1S/C10H17FN2O2S/c1-10(2,3)15-9(14)13-5-6(11)4-7(13)8(12)16/h6-7H,4-5H2,1-3H3,(H2,12,16)/t6-,7-/m0/s1 |
| InChIKey | OFGDUYOUGGQWAV-BQBZGAKWSA-N |
| XLogP | 1.62 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|