C10H18FN3O3 — CID 90181745
tert-butyl (2S,4S)-4-fluoro-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate (PubChem CID 90181745) has the molecular formula C10H18FN3O3 and a molecular weight of 247.27 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-fluoro-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90181745 |
| Molecular Formula | C10H18FN3O3 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1C(=O)NN |
| InChI | InChI=1S/C10H18FN3O3/c1-10(2,3)17-9(16)14-5-6(11)4-7(14)8(15)13-12/h6-7H,4-5,12H2,1-3H3,(H,13,15)/t6-,7-/m0/s1 |
| InChIKey | QXKYYQNHVVYPGS-BQBZGAKWSA-N |
| XLogP | 0.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|