C21H38N6O7 — CID 90181738
tert-butyl (2S,4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate (PubChem CID 90181738) has the molecular formula C21H38N6O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90181738 |
| Molecular Formula | C21H38N6O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | tert-butyl (2S,4S)-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(hydrazinecarbonyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NC(=N[C@H]1C[C@@H](C(=O)NN)N(C(=O)OC(C)(C)C)C1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38N6O7/c1-19(2,3)32-16(29)24-15(25-17(30)33-20(4,5)6)23-12-10-13(14(28)26-22)27(11-12)18(31)34-21(7,8)9/h12-13H,10-11,22H2,1-9H3,(H,26,28)(H2,23,24,25,29,30)/t12-,13-/m0/s1 |
| InChIKey | JISHYGOPOQIOKT-STQMWFEESA-N |
| XLogP | 1.76 |
| TPSA | 173.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|