C12H20N2O4S — CID 170299525
1-O-tert-butyl 2-O-methyl (4R)-4-carbamothioylpyrrolidine-1,2-dicarboxylate (PubChem CID 170299525) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (4R)-4-carbamothioylpyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (4R)-4-carbamothioylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170299525 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (4R)-4-carbamothioylpyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1C[C@@H](C(N)=S)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O4S/c1-12(2,3)18-11(16)14-6-7(9(13)19)5-8(14)10(15)17-4/h7-8H,5-6H2,1-4H3,(H2,13,19)/t7-,8?/m1/s1 |
| InChIKey | CGSQPNMRKUXFJM-GVHYBUMESA-N |
| XLogP | 1.07 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|