C13H21NO4S — CID 141278726
methyl (2S,4R)-4-acetyl-1-[(2-methylpropan-2-yl)oxycarbothioyl]pyrrolidine-2-carboxylate (PubChem CID 141278726) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is methyl (2S,4R)-4-acetyl-1-[(2-methylpropan-2-yl)oxycarbothioyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-acetyl-1-[(2-methylpropan-2-yl)oxycarbothioyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141278726 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl (2S,4R)-4-acetyl-1-[(2-methylpropan-2-yl)oxycarbothioyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](C(C)=O)CN1C(=S)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO4S/c1-8(15)9-6-10(11(16)17-5)14(7-9)12(19)18-13(2,3)4/h9-10H,6-7H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | OEXKKPPJFOKTEW-ZJUUUORDSA-N |
| XLogP | 1.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|