C9H13NO6 — CID 154464394
2,4-bis(methoxycarbonyl)pyrrolidine-1-carboxylic acid (PubChem CID 154464394) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is 2,4-bis(methoxycarbonyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2,4-bis(methoxycarbonyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154464394 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2,4-bis(methoxycarbonyl)pyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)C1CC(C(=O)OC)N(C(=O)O)C1 |
| InChI | InChI=1S/C9H13NO6/c1-15-7(11)5-3-6(8(12)16-2)10(4-5)9(13)14/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | ZQPPDAHUEUFSQY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |