About 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate
2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate (PubChem CID 142739823) has the molecular formula C11H19NO4S
and a molecular weight of 261.34 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate.
Analyze 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate (CID 142739823) is 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate is CCOC(=O)N1CCSC1C(=O)OC(C)(C)C.
What is the InChIKey of 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate?
The InChIKey is NFOILVWXKUWWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO4S/c1-5-15-10(14)12-6-7-17-8(12)9(13)16-11(2,3)4/h8H,5-7H2,1-4H3.
What are the key properties of 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate?
2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate has a molecular weight of 261.34 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 3-O-ethyl 1,3-thiazolidine-2,3-dicarboxylate is sourced from PubChem (CID 142739823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).