C11H18N2O4S — CID 59927086
tert-butyl N-[2-[(2S)-2-formyl-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate (PubChem CID 59927086) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-2-formyl-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S)-2-formyl-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 59927086 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | tert-butyl N-[2-[(2S)-2-formyl-1,3-thiazolidin-3-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCS[C@H]1C=O |
| InChI | InChI=1S/C11H18N2O4S/c1-11(2,3)17-10(16)12-6-8(15)13-4-5-18-9(13)7-14/h7,9H,4-6H2,1-3H3,(H,12,16)/t9-/m0/s1 |
| InChIKey | ZDNPZLDQTBZJDR-VIFPVBQESA-N |
| XLogP | 0.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|