C12H22N2O3S — CID 20623549
tert-butyl N-[2-oxo-2-[2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 20623549) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 20623549 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[2-(sulfanylmethyl)pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCCC1CS |
| InChI | InChI=1S/C12H22N2O3S/c1-12(2,3)17-11(16)13-7-10(15)14-6-4-5-9(14)8-18/h9,18H,4-8H2,1-3H3,(H,13,16) |
| InChIKey | UGJOHOHHKGUGDD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|