C15H30N2O5 — CID 143037682
tert-butyl N-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]carbamate;ethane;formic acid (PubChem CID 143037682) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is tert-butyl N-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]carbamate;ethane;formic acid.
| Compound Name | tert-butyl N-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]carbamate;ethane;formic acid |
|---|---|
| PubChem CID | 143037682 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | tert-butyl N-[2-(2-methylpyrrolidin-1-yl)-2-oxoethyl]carbamate;ethane;formic acid |
| SMILES | CC.CC1CCCN1C(=O)CNC(=O)OC(C)(C)C.O=CO |
| InChI | InChI=1S/C12H22N2O3.C2H6.CH2O2/c1-9-6-5-7-14(9)10(15)8-13-11(16)17-12(2,3)4;1-2;2-1-3/h9H,5-8H2,1-4H3,(H,13,16);1-2H3;1H,(H,2,3) |
| InChIKey | DRQFVGNZFGNDNM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|