C16H32N2O3 — CID 142306619
tert-butyl N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]carbamate;propane (PubChem CID 142306619) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is tert-butyl N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]carbamate;propane.
| Compound Name | tert-butyl N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]carbamate;propane |
|---|---|
| PubChem CID | 142306619 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | tert-butyl N-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]carbamate;propane |
| SMILES | CC1CCCN(C(=O)CNC(=O)OC(C)(C)C)C1.CCC |
| InChI | InChI=1S/C13H24N2O3.C3H8/c1-10-6-5-7-15(9-10)11(16)8-14-12(17)18-13(2,3)4;1-3-2/h10H,5-9H2,1-4H3,(H,14,17);3H2,1-2H3 |
| InChIKey | WYAXVEJBVSGAGJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |