C12H19F3N2O4 — CID 178127237
tert-butyl N-[2-oxo-2-[3-(trifluoromethoxy)pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 178127237) has the molecular formula C12H19F3N2O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[3-(trifluoromethoxy)pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[3-(trifluoromethoxy)pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 178127237 |
| Molecular Formula | C12H19F3N2O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[3-(trifluoromethoxy)pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCC(OC(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N2O4/c1-11(2,3)21-10(19)16-6-9(18)17-5-4-8(7-17)20-12(13,14)15/h8H,4-7H2,1-3H3,(H,16,19) |
| InChIKey | UCSGYEZLQVCYIA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |