About 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde
4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde (PubChem CID 163386470) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde |
| PubChem CID | 163386470 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde |
| SMILES | CC(C(=O)N1CC(O)CC1C=O)C(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-8(12(2,3)4)11(16)13-6-10(15)5-9(13)7-14/h7-10,15H,5-6H2,1-4H3 |
| InChIKey | BBCPUPHZGREPDH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde?
The IUPAC name of 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde (CID 163386470) is 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde.
What is the SMILES notation for 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde?
The canonical SMILES for 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde is CC(C(=O)N1CC(O)CC1C=O)C(C)(C)C.
What is the InChIKey of 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde?
The InChIKey is BBCPUPHZGREPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8(12(2,3)4)11(16)13-6-10(15)5-9(13)7-14/h7-10,15H,5-6H2,1-4H3.
What are the key properties of 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde?
4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde has a molecular weight of 227.30 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-(2,3,3-trimethylbutanoyl)pyrrolidine-2-carbaldehyde is sourced from PubChem (CID 163386470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).