C6H9NO4 — CID 87590455
(2S,4R)-2-formyl-4-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 87590455) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is (2S,4R)-2-formyl-4-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-formyl-4-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87590455 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2S,4R)-2-formyl-4-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | O=C[C@@H]1C[C@@H](O)CN1C(=O)O |
| InChI | InChI=1S/C6H9NO4/c8-3-4-1-5(9)2-7(4)6(10)11/h3-5,9H,1-2H2,(H,10,11)/t4-,5+/m0/s1 |
| InChIKey | KUZPAYZGPUGZSU-CRCLSJGQSA-N |
| XLogP | -0.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|