C10H16N2O5 — CID 87617088
(2R,5S)-2-formyl-5-propan-2-ylpiperazine-1,4-dicarboxylic acid (PubChem CID 87617088) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2R,5S)-2-formyl-5-propan-2-ylpiperazine-1,4-dicarboxylic acid.
| Compound Name | (2R,5S)-2-formyl-5-propan-2-ylpiperazine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 87617088 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2R,5S)-2-formyl-5-propan-2-ylpiperazine-1,4-dicarboxylic acid |
| SMILES | CC(C)[C@H]1CN(C(=O)O)[C@@H](C=O)CN1C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c1-6(2)8-4-11(9(14)15)7(5-13)3-12(8)10(16)17/h5-8H,3-4H2,1-2H3,(H,14,15)(H,16,17)/t7-,8-/m1/s1 |
| InChIKey | XCQORNNKOPZMPU-HTQZYQBOSA-N |
| XLogP | 0.55 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|