About (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid
(2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 170164416) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid |
| PubChem CID | 170164416 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)[C@H]1C[C@@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C9H15NO4/c1-5(2)6-3-7(8(11)12)10(4-6)9(13)14/h5-7H,3-4H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | JXZPCNFIWUJCIW-BQBZGAKWSA-N |
| XLogP | 1.10 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid (CID 170164416) is (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid is CC(C)[C@H]1C[C@@H](C(=O)O)N(C(=O)O)C1.
What is the InChIKey of (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid?
The InChIKey is JXZPCNFIWUJCIW-BQBZGAKWSA-N. The full InChI is InChI=1S/C9H15NO4/c1-5(2)6-3-7(8(11)12)10(4-6)9(13)14/h5-7H,3-4H2,1-2H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1.
What are the key properties of (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid?
(2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid has a molecular weight of 201.22 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-propan-2-ylpyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 170164416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).