4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid

C11H18N2O4 — CID 139534258

IUPAC4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid
SMILESO=C(O)C1CC(N2CCCCC2)CN1C(=O)O
InChIInChI=1S/C11H18N2O4/c14-10(15)9-6-8(7-13(9)11(16)17)12-4-2-1-3-5-12/h8-9H,1-7H2,(H,14,15)(H,16,17)
InChIKeyQAVPZOWESBGROX-UHFFFAOYSA-N
MW242.27 g/mol
LogP0.68
Rot. Bonds2

About 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid

4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 139534258) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid
PubChem CID139534258
Molecular FormulaC11H18N2O4
Molecular Weight242.27 g/mol
Exact Mass242.13
IUPAC Name4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid
SMILESO=C(O)C1CC(N2CCCCC2)CN1C(=O)O
InChIInChI=1S/C11H18N2O4/c14-10(15)9-6-8(7-13(9)11(16)17)12-4-2-1-3-5-12/h8-9H,1-7H2,(H,14,15)(H,16,17)
InChIKeyQAVPZOWESBGROX-UHFFFAOYSA-N
XLogP0.68
TPSA81.08 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.27
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid (CID 139534258) is 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid is O=C(O)C1CC(N2CCCCC2)CN1C(=O)O.
What is the InChIKey of 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid?
The InChIKey is QAVPZOWESBGROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c14-10(15)9-6-8(7-13(9)11(16)17)12-4-2-1-3-5-12/h8-9H,1-7H2,(H,14,15)(H,16,17).
What are the key properties of 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid?
4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid has a molecular weight of 242.27 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-ylpyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 139534258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).