C13H21NO4 — CID 90802821
4-(cyclohexylmethyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 90802821) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | 4-(cyclohexylmethyl)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90802821 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 4-(cyclohexylmethyl)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC(CC2CCCCC2)CN1C(=O)O |
| InChI | InChI=1S/C13H21NO4/c15-12(16)11-7-10(8-14(11)13(17)18)6-9-4-2-1-3-5-9/h9-11H,1-8H2,(H,15,16)(H,17,18) |
| InChIKey | QMWXCNZQZRVOGS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |