C11H16N2O5 — CID 153347204
(2R,4R)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 153347204) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (2R,4R)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4R)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 153347204 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2R,4R)-4-(pyrrolidine-1-carbonyl)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](C(=O)N2CCCC2)CN1C(=O)O |
| InChI | InChI=1S/C11H16N2O5/c14-9(12-3-1-2-4-12)7-5-8(10(15)16)13(6-7)11(17)18/h7-8H,1-6H2,(H,15,16)(H,17,18)/t7-,8-/m1/s1 |
| InChIKey | YQFRWCBSEJDCSU-HTQZYQBOSA-N |
| XLogP | 0.06 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |