C7H12N2O4 — CID 22181503
4-(methylamino)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 22181503) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 22181503 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CNC1CC(C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C7H12N2O4/c1-8-4-2-5(6(10)11)9(3-4)7(12)13/h4-5,8H,2-3H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | MFHGRSMAIMOMED-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |