4-(methylamino)pyrrolidine-1,2-dicarboxylic acid

C7H12N2O4 — CID 22181503

IUPAC4-(methylamino)pyrrolidine-1,2-dicarboxylic acid
SMILESCNC1CC(C(=O)O)N(C(=O)O)C1
InChIInChI=1S/C7H12N2O4/c1-8-4-2-5(6(10)11)9(3-4)7(12)13/h4-5,8H,2-3H2,1H3,(H,10,11)(H,12,13)
InChIKeyMFHGRSMAIMOMED-UHFFFAOYSA-N
MW188.18 g/mol
LogP-0.59
Rot. Bonds2

About 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid

4-(methylamino)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 22181503) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name4-(methylamino)pyrrolidine-1,2-dicarboxylic acid
PubChem CID22181503
Molecular FormulaC7H12N2O4
Molecular Weight188.18 g/mol
Exact Mass188.08
IUPAC Name4-(methylamino)pyrrolidine-1,2-dicarboxylic acid
SMILESCNC1CC(C(=O)O)N(C(=O)O)C1
InChIInChI=1S/C7H12N2O4/c1-8-4-2-5(6(10)11)9(3-4)7(12)13/h4-5,8H,2-3H2,1H3,(H,10,11)(H,12,13)
InChIKeyMFHGRSMAIMOMED-UHFFFAOYSA-N
XLogP-0.59
TPSA89.87 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.18
LogP ≤ 5-0.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid (CID 22181503) is 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid is CNC1CC(C(=O)O)N(C(=O)O)C1.
What is the InChIKey of 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid?
The InChIKey is MFHGRSMAIMOMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4/c1-8-4-2-5(6(10)11)9(3-4)7(12)13/h4-5,8H,2-3H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid?
4-(methylamino)pyrrolidine-1,2-dicarboxylic acid has a molecular weight of 188.18 g/mol, XLogP of -0.59, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)pyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 22181503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).