C11H16N2O6 — CID 66964992
(2R,4S)-4-[(2-oxo-2-prop-2-enoxyethyl)amino]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 66964992) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is (2R,4S)-4-[(2-oxo-2-prop-2-enoxyethyl)amino]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4S)-4-[(2-oxo-2-prop-2-enoxyethyl)amino]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 66964992 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2R,4S)-4-[(2-oxo-2-prop-2-enoxyethyl)amino]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | C=CCOC(=O)CN[C@H]1C[C@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C11H16N2O6/c1-2-3-19-9(14)5-12-7-4-8(10(15)16)13(6-7)11(17)18/h2,7-8,12H,1,3-6H2,(H,15,16)(H,17,18)/t7-,8+/m0/s1 |
| InChIKey | WWUPLPNHOIGBAO-JGVFFNPUSA-N |
| XLogP | -0.49 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|